Compound Q&A

What is Cyanidin-3-O-galactoside chloride (CAS: 27661-36-5)?

Answer

Cyanidin-3-O-galactoside chloride
Cyanidin-3-O-galactoside chloride is a flavonoid derivative with a unique chemical structure, characterized by the presence of cyanidin aglycone attached to galactose through a 3-O-glycosidic bond, and further chloride ion substitution. It has antioxidant and anti-inflammatory properties and is commonly used in research and food additives.

About

CAS No 27661-36-5
English Name Cyanidin-3-O-galactoside chloride
Molecular Formula C21H21ClO11
Molecular Weight 484.8 g/mol
SMILES C1=CC(=C(C=C1C2=[O+]C3=CC(=CC(=C3C=C2OC4C(C(C(C(O4)CO)O)O)O)O)O)O)O.[Cl-]
InChIKey YTMNONATNXDQJF-QSLGVYCOSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What are the main uses of Cyanidin-3-O-galactoside chloride (CAS: 27661-36-5)?

Cyanidin-3-O-galactoside chloride is primarily used in food coloring, as a natural pigment in bevera...

Compound Q&A

Is Cyanidin-3-O-galactoside chloride (CAS: 27661-36-5) safe?

Cyanidin-3-O-galactoside chloride is considered safe for ingestion when used within recommended dosa...

Compound Q&A

How should Cyanidin-3-O-galactoside chloride (CAS: 27661-36-5) be stored?

Cyanidin-3-O-galactoside chloride should be stored in a cool, dry place away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...