Compound Q&A

Is β-Elemonic acid (CAS: 28282-25-9) safe?

Answer

β-Elemonic acid
β-Elemonic acid is generally considered safe when used appropriately. However, it should be handled with care due to its potential to cause skin irritation. Protective gloves and eyewear should be worn during handling.

About

CAS No 28282-25-9
English Name β-Elemonic acid
Molecular Formula C30H46O3
Molecular Weight 454.7 g/mol
SMILES CC(=CCCC(C1CCC2(C1(CCC3=C2CCC4C3(CCC(=O)C4(C)C)C)C)C)C(=O)O)C
InChIKey XLPAINGDLCDYQV-SDTWUMECSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What is β-Elemonic acid (CAS: 28282-25-9)?

β-Elemonic acid is a triterpene acid found in plants, particularly in the roots of ginseng. Its chem...

Compound Q&A

What are the main uses of β-Elemonic acid (CAS: 28282-25-9)?

β-Elemonic acid is primarily used in the pharmaceutical industry for its potential anti-inflammatory...

Compound Q&A

How should β-Elemonic acid (CAS: 28282-25-9) be stored?

β-Elemonic acid should be stored in a cool, dry place, away from direct sunlight and heat sources. I...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...