Compound Q&A

What is (2S)-Amino(2-chlorophenyl)acetic acid (CAS: 141315-50-6)?

Answer

(2S)-Amino(2-chlorophenyl)acetic acid
(2S)-Amino(2-chlorophenyl)acetic acid, also known as 2-(2-Chlorophenyl)glycine, is a chemical compound with a CAS number of 141315-50-6. It is an amino acid derivative with an amino group attached to a 2-chlorophenyl ring. This compound has a molecular formula of C9H9ClNO2 and is used in various applications such as pharmaceuticals and research due to its unique chemical properties.

About

English Name (2S)-Amino(2-chlorophenyl)acetic acid
Molecular Formula C8H8ClNO2
Molecular Weight 185.61 g/mol
SMILES C1=CC=C(C(=C1)C(C(=O)O)N)Cl
InChIKey LMIZLNPFTRQPSF-ZETCQYMHSA-N
Last Updated: 2025-09-25 07:24

Related Q&A

Compound Q&A

What are the main uses of (2S)-Amino(2-chlorophenyl)acetic acid (CAS: 141315-50-6)?

(2S)-Amino(2-chlorophenyl)acetic acid is primarily used in the pharmaceutical industry as a precurso...

Compound Q&A

Is (2S)-Amino(2-chlorophenyl)acetic acid (CAS: 141315-50-6) safe?

(2S)-Amino(2-chlorophenyl)acetic acid is generally considered safe when handled with appropriate pre...

Compound Q&A

How should (2S)-Amino(2-chlorophenyl)acetic acid (CAS: 141315-50-6) be stored?

(2S)-Amino(2-chlorophenyl)acetic acid should be stored in a cool, dry place away from direct sunligh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...