Compound Q&A

How should (2,3,5-Trichlorophenyl)boronic acid (CAS: 212779-19-6) be stored?

Answer

(2,3,5-Trichlorophenyl)boronic acid
(2,3,5-Trichlorophenyl)boronic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture and degradation. Storage should be done in a well-ventilated area to avoid inhaling the fumes. It is also advisable to store it away from incompatible materials such as strong acids and bases to prevent chemical reactions.

About

English Name (2,3,5-Trichlorophenyl)boronic acid
Molecular Formula C6H4BCl3O2
Molecular Weight 225.27 g/mol
SMILES B(C1=CC(=CC(=C1Cl)Cl)Cl)(O)O
InChIKey OPBCCRZCYTUJMS-UHFFFAOYSA-N
Last Updated: 2025-09-24 16:40

Related Q&A

Compound Q&A

What is (2,3,5-Trichlorophenyl)boronic acid (CAS: 212779-19-6)?

(2,3,5-Trichlorophenyl)boronic acid is an organic compound with the formula C7H3Cl3BO3. It is a whit...

Compound Q&A

What are the main uses of (2,3,5-Trichlorophenyl)boronic acid (CAS: 212779-19-6)?

(2,3,5-Trichlorophenyl)boronic acid is primarily used in organic synthesis, particularly in asymmetr...

Compound Q&A

Is (2,3,5-Trichlorophenyl)boronic acid (CAS: 212779-19-6) safe?

(2,3,5-Trichlorophenyl)boronic acid is generally considered safe for laboratory use when proper safe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...