Compound Q&A

What is 6-Bromo-4-chloro-3-nitroquinoline (CAS: 723281-72-9)?

Answer

6-Bromo-4-chloro-3-nitroquinoline
6-Bromo-4-chloro-3-nitroquinoline is an organic compound with the CAS number 723281-72-9. It has a molecular formula of C9H5BrClN3 and is characterized by its chromophoric nature and potential reactivity in chemical reactions.

About

English Name 6-Bromo-4-chloro-3-nitroquinoline
Molecular Formula C9H4BrClN2O2
Molecular Weight 287.5 g/mol
SMILES C1=CC2=NC=C(C(=C2C=C1Br)Cl)[N+](=O)[O-]
InChIKey KHKPVEMMXJCWGP-UHFFFAOYSA-N
Last Updated: 2025-09-24 16:40

Related Q&A

Compound Q&A

What are the main uses of 6-Bromo-4-chloro-3-nitroquinoline (CAS: 723281-72-9)?

6-Bromo-4-chloro-3-nitroquinoline is primarily used in research and development for its reactivity a...

Compound Q&A

Is 6-Bromo-4-chloro-3-nitroquinoline (CAS: 723281-72-9) safe?

6-Bromo-4-chloro-3-nitroquinoline is not considered safe for general handling due to its potentially...

Compound Q&A

How should 6-Bromo-4-chloro-3-nitroquinoline (CAS: 723281-72-9) be stored?

6-Bromo-4-chloro-3-nitroquinoline should be stored in a cool, dry place away from direct sunlight an...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...