Compound Q&A

What is 2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8)?

Answer

2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione
2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) is a chemical compound with a molecular structure characterized by a chromene ring system. It is a derivative of chromene with specific functional groups. This compound is used in various applications and is also studied for its potential in medicinal chemistry.

About

CAS No 4707-32-8
English Name 2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione
Molecular Formula C15H14O3
Molecular Weight 242.27 g/mol
SMILES O=C1C2=C(OC(CC2)(C)C)c2c(C1=O)cccc2
InChIKey QZPQTZZNNJUOLS-UHFFFAOYSA-N
Last Updated: 2025-09-24 16:40

Related Q&A

Compound Q&A

What are the main uses of 2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8)?

2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) is primarily used in the pha...

Compound Q&A

Is 2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) safe?

2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) is generally considered safe...

Compound Q&A

How should 2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) be stored?

2,2-Dimethyl-3,4-dihydro-2H-benzo[h]chromene-5,6-dione (CAS: 4707-32-8) should be stored in a cool, ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...