Compound Q&A

What is Baloxavir Marboxil Impurity 6 (CAS: 1985607-70-2)?

Answer

Baloxavir Marboxil Impurity 6
Baloxavir Marboxil Impurity 6 is a byproduct in the synthesis of baloxavir marboxil, an antiviral drug used to treat influenza. It does not have a distinct chemical formula but is characterized by its presence in the production process.

About

English Name Baloxavir Marboxil Impurity 6
Molecular Formula C17H17N3O4
Molecular Weight 327.34 g/mol
SMILES O=c1ccn2c(c1OCc1ccccc1)C(=O)N1[C@H](N2)COCC1
InChIKey HJTRSKVIYMCKJU-AWEZNQCLSA-N
Last Updated: 2025-09-24 08:06

Related Q&A

Compound Q&A

What are the main uses of Baloxavir Marboxil Impurity 6 (CAS: 1985607-70-2)?

Baloxavir Marboxil Impurity 6 is primarily used in the pharmaceutical industry as an intermediate in...

Compound Q&A

Is Baloxavir Marboxil Impurity 6 (CAS: 1985607-70-2) safe?

Baloxavir Marboxil Impurity 6 is generally considered safe for handling under standard laboratory co...

Compound Q&A

How should Baloxavir Marboxil Impurity 6 (CAS: 1985607-70-2) be stored?

Baloxavir Marboxil Impurity 6 should be stored in a cool, dry place away from direct sunlight and he...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...