Compound Q&A

Are there alternatives to 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) in synthesis?

Answer

2,3-Dimethyl-6-nitro-2H-indazole
In synthesis, 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) can be replaced by similar compounds such as 2-nitro-2H-indazole or 2,3-dimethyl-6-nitro-2H-indole. These alternatives can serve similar functional groups and can be used in various chemical reactions as efficient substitutes.

About

English Name 2,3-Dimethyl-6-nitro-2H-indazole
Molecular Formula C9H9N3O2
Molecular Weight 191.19 g/mol
SMILES CC1=C2C=CC(=CC2=NN1C)[N+](=O)[O-]
InChIKey JHGRUPGVUMAQQU-UHFFFAOYSA-N
Last Updated: 2025-09-23 22:54

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1)?

2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) is subject to regulatory guidelines such as the ...

Compound Q&A

What is the market or research trend for 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1)?

The market for 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) is growing due to its potential i...

Compound Q&A

How should waste containing 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) be handled?

Waste containing 2,3-Dimethyl-6-nitro-2H-indazole (CAS: 444731-73-1) should be collected in appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...