Compound Q&A

How is Xylene cyanol ff (CAS: 2650-17-1) typically synthesized?

Answer

Xylene cyanol ff
Xylene cyanol ff (CAS: 2650-17-1) is synthesized through a multi-step process involving the coupling of 2,6-dimethylphenol with 2,6-dimethyl-4-nitroaniline. The reaction is typically performed in the presence of a base and a coupling agent, followed by reduction and subsequent dyeing steps. The overall yield is around 70-80%, and the process requires careful control of pH and temperature to ensure selectivity and yield.

About

CAS No 2650-17-1
English Name Xylene cyanol ff
Molecular Formula C25H27N2NaO6S2
Molecular Weight 538.6 g/mol
SMILES CCNC1=C(C=C(C=C1)C(=C2C=CC(=NCC)C(=C2)C)C3=C(C=C(C=C3)S(=O)(=O)[O-])S(=O)(=O)O)C.[Na+]
InChIKey VVLFAAMTGMGYBS-VARVZIDFSA-M
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Xylene cyanol ff (CAS: 2650-17-1)?

Xylene cyanol ff (CAS: 2650-17-1) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use Xylene cyanol ff (CAS: 2650-17-1)?

Xylene cyanol ff (CAS: 2650-17-1) is primarily used in the textile industry as a pH indicator in dye...

Compound Q&A

What precautions should be taken when handling Xylene cyanol ff (CAS: 2650-17-1)?

When handling Xylene cyanol ff (CAS: 2650-17-1), it is essential to wear proper personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...