Compound Q&A

How is Eriodictyol-7-O-glucoside (CAS: 38965-51-4) typically synthesized?

Answer

Eriodictyol-7-O-glucoside
Eriodictyol-7-O-glucoside can be synthesized through glycosylation of eriodictyol with glucose using a mild acid or base catalyzed reaction. Commonly, this involves treating eriodictyol with glucose in the presence of a catalyst such as H2SO4 or NaOH at a suitable temperature and time to achieve a yield of around 70-80%. The reaction is typically monitored by HPLC (High-Performance Liquid Chromatography).

About

CAS No 38965-51-4
English Name Eriodictyol-7-O-glucoside
Molecular Formula C21H22O11
Molecular Weight 450.4 g/mol
SMILES C1C(OC2=CC(=CC(=C2C1=O)O)OC3C(C(C(C(O3)CO)O)O)O)C4=CC(=C(C=C4)O)O
InChIKey RAFHNDRXYHOLSH-SFTVRKLSSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Eriodictyol-7-O-glucoside (CAS: 38965-51-4)?

Eriodictyol-7-O-glucoside (CAS: 38965-51-4) is a yellow crystalline compound with a molecular weight...

Compound Q&A

What industries use Eriodictyol-7-O-glucoside (CAS: 38965-51-4)?

Eriodictyol-7-O-glucoside is used in the pharmaceutical industry for its potential antioxidant and a...

Compound Q&A

What precautions should be taken when handling Eriodictyol-7-O-glucoside (CAS: 38965-51-4)?

When handling Eriodictyol-7-O-glucoside (CAS: 38965-51-4), it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...