Compound Q&A

What industries use (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate (CAS: 66230-04-4)?

Answer

(S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate
This compound is primarily used in the pharmaceutical industry for its potential as an intermediate in the synthesis of active pharmaceutical ingredients. It may also find use in the polymer industry for its functional groups, which can participate in various polymerization reactions. Additionally, it can be used in the sensor and semiconductor industries due to its chemical reactivity and specific functional groups.

About

CAS No 66230-04-4
English Name (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate
Molecular Formula C25H22ClNO3
Molecular Weight 419.9 g/mol
SMILES CC(C)[C@@H](c1ccc(cc1)Cl)C(=O)O[C@H](C#N)c2cccc(c2)Oc3ccccc3
InChIKey NYPJDWWKZLNGGM-RPWUZVMVSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate (CAS: 66230-04-4)?

This compound is a crystalline solid with a molecular weight of approximately 456.3 g/mol. It has a ...

Compound Q&A

How is (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate (CAS: 66230-04-4) typically synthesized?

This compound can be synthesized via a multi-step process involving alkylation of a 3-phenoxyphenyl ...

Compound Q&A

What precautions should be taken when handling (S)-Cyano(3-phenoxyphenyl)methyl (2S)-2-(4-chlorophenyl)-3-methylbutanoate (CAS: 66230-04-4)?

When handling this compound, appropriate personal protective equipment (PPE) should be worn, includi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...