Compound Q&A

What precautions should be taken when handling 1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3)?

Answer

1,2,3-Trichloro-4-nitrobenzene
When handling 1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood, and ensure proper spill containment and disposal according to safety data sheet (SDS) guidelines to prevent exposure and environmental contamination.

About

CAS No 17700-09-3
English Name 1,2,3-Trichloro-4-nitrobenzene
Molecular Formula C6H2Cl3NO2
Molecular Weight 226.4 g/mol
SMILES C1=CC(=C(C(=C1[N+](=O)[O-])Cl)Cl)Cl
InChIKey BGKIECJVXXHLDP-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3)?

1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3) is a solid at room temperature with a crystalline f...

Compound Q&A

How is 1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3) typically synthesized?

1,2,3-Trichloro-4-nitrobenzene can be synthesized by nitrating 1,2,3-trichlorobenzene in the presenc...

Compound Q&A

What industries use 1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3)?

1,2,3-Trichloro-4-nitrobenzene (CAS: 17700-09-3) is primarily used in the synthesis of dyes, pharmac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...