Compound Q&A

What are the physical and chemical properties of Rimegepant (CAS: 1289023-67-1)?

Answer

Rimegepant
Rimegepant is a selective calcitonin gene-related peptide receptor antagonist. It is available as a crystalline compound with a molecular weight of approximately 425.47 g/mol. Rimegepant has a solubility of about 2.2 mg/mL in water and is practically insoluble in organic solvents like ethanol and chloroform. Its chemical reactivity is low under normal conditions, but it is susceptible to degradation under acidic or alkaline conditions.

About

English Name Rimegepant
Molecular Formula C28H28F2N6O3
Molecular Weight 534.57 g/mol
SMILES C1CC(C2=C(C=CC=N2)C(C1C3=C(C(=CC=C3)F)F)N)OC(=O)N4CCC(CC4)N5C6=C(NC5=O)N=CC=C6
InChIKey KRNAOFGYEFKHPB-ANJVHQHFSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

How is Rimegepant (CAS: 1289023-67-1) typically synthesized?

Rimegepant is synthesized through a multi-step process involving peptide coupling and protection/dep...

Compound Q&A

What industries use Rimegepant (CAS: 1289023-67-1)?

Rimegepant is primarily used in the pharmaceutical industry, specifically for the prevention of migr...

Compound Q&A

What precautions should be taken when handling Rimegepant (CAS: 1289023-67-1)?

When handling Rimegepant, it is essential to use appropriate personal protective equipment (PPE), su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...