Compound Q&A

How is Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1) typically synthesized?

Answer

Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-)
Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) can be synthesized through a multi-step process involving the reaction of sodium hydride with 3,5-bis(trifluoromethyl)phenylboronic acid. The reaction typically requires a coordinating solvent and is carried out under an inert atmosphere to ensure a high yield and good selectivity.

About

CAS No 79060-88-1
English Name Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-)
Molecular Formula C32H12BF24Na
Molecular Weight 886.2 g/mol
SMILES [B-](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)(C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F.[Na+]
InChIKey LTGMONZOZHXAHO-UHFFFAOYSA-N
Last Updated: 2025-09-23 10:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1)?

Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1) is a white crystalline s...

Compound Q&A

What industries use Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1)?

Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1) is primarily used in pha...

Compound Q&A

What precautions should be taken when handling Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1)?

When handling Sodium tetrakis[3,5-bis(trifluoromethyl)phenyl]borate(1-) (CAS: 79060-88-1), use appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...