Compound Q&A

What are the physical and chemical properties of N-benzyl-6-(4-phenylbutoxy)hexan-1-amine (CAS: 97664-55-6)?

Answer

N-benzyl-6-(4-phenylbutoxy)hexan-1-amine
N-benzyl-6-(4-phenylbutoxy)hexan-1-amine is a crystalline solid with a molecular weight of approximately 344.42 g/mol. It has a high solubility in organic solvents such as ethanol and acetone but is only slightly soluble in water. Chemically, it is reactive towards acids and bases, making it useful in various chemical reactions. The compound is stable under normal conditions but should be stored away from strong acids and bases.

About

CAS No 97664-55-6
English Name N-benzyl-6-(4-phenylbutoxy)hexan-1-amine
Molecular Formula C23H33NO
Molecular Weight 339.52 g/mol
SMILES C1=CC=C(C=C1)CCCCOCCCCCCNCC2=CC=CC=C2
InChIKey JWLIKZBRVQRFNF-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is N-benzyl-6-(4-phenylbutoxy)hexan-1-amine (CAS: 97664-55-6) typically synthesized?

N-benzyl-6-(4-phenylbutoxy)hexan-1-amine is typically synthesized using a multistep process involvin...

Compound Q&A

What industries use N-benzyl-6-(4-phenylbutoxy)hexan-1-amine (CAS: 97664-55-6)?

N-benzyl-6-(4-phenylbutoxy)hexan-1-amine is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling N-benzyl-6-(4-phenylbutoxy)hexan-1-amine (CAS: 97664-55-6)?

When handling N-benzyl-6-(4-phenylbutoxy)hexan-1-amine, it is important to use proper personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...