Compound Q&A

What are the physical and chemical properties of Estra-4,9-diene-3,17-dione (CAS: 5173-46-6)?

Answer

Estra-4,9-diene-3,17-dione
Estra-4,9-diene-3,17-dione (CAS: 5173-46-6) is a steroid compound. It is a white solid with a molecular weight of approximately 252.38 g/mol. The compound is slightly soluble in water but soluble in organic solvents like ethanol and acetone. It is chemically stable but can undergo reactions under certain conditions, such as in the presence of light or heat.

About

CAS No 5173-46-6
English Name Estra-4,9-diene-3,17-dione
Molecular Formula C18H22O2
Molecular Weight 270.37 g/mol
SMILES C[C@]1([C@](CC2)([H])[C@]3([H])CCC4=CC(CCC4=C3CC1)=O)C2=O
InChIKey BHTWZQKERRCPRZ-RYRKJORJSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Estra-4,9-diene-3,17-dione (CAS: 5173-46-6) typically synthesized?

Estra-4,9-diene-3,17-dione can be synthesized through the dehydrogenation of estrane-4,9-diene-3,17-...

Compound Q&A

What industries use Estra-4,9-diene-3,17-dione (CAS: 5173-46-6)?

Estra-4,9-diene-3,17-dione (CAS: 5173-46-6) is primarily used in the pharmaceutical industry for the...

Compound Q&A

What precautions should be taken when handling Estra-4,9-diene-3,17-dione (CAS: 5173-46-6)?

When handling Estra-4,9-diene-3,17-dione (CAS: 5173-46-6), it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...