Compound Q&A

What industries use [4-(Trifluoromethyl)phenyl]acetic acid (CAS: 32857-62-8)?

Answer

[4-(Trifluoromethyl)phenyl]acetic acid
[4-(Trifluoromethyl)phenyl]acetic acid finds application in the pharmaceutical industry for the synthesis of various drug molecules due to its unique substituent. It is also used in the polymer industry as a monomer for the synthesis of fluorinated polymers. Additionally, it is employed in the production of sensors and semiconductors for its electronic properties.

About

CAS No 32857-62-8
English Name [4-(Trifluoromethyl)phenyl]acetic acid
Molecular Formula C9H7F3O2
Molecular Weight 204.15 g/mol
SMILES C1=CC(=CC=C1CC(=O)O)C(F)(F)F
InChIKey HNORVZDAANCHAY-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4-(Trifluoromethyl)phenyl]acetic acid (CAS: 32857-62-8)?

[4-(Trifluoromethyl)phenyl]acetic acid is a white or light yellow crystalline solid with a molecular...

Compound Q&A

How is [4-(Trifluoromethyl)phenyl]acetic acid (CAS: 32857-62-8) typically synthesized?

[4-(Trifluoromethyl)phenyl]acetic acid can be synthesized by reacting 4-(trifluoromethyl)benzaldehyd...

Compound Q&A

What precautions should be taken when handling [4-(Trifluoromethyl)phenyl]acetic acid (CAS: 32857-62-8)?

When handling [4-(Trifluoromethyl)phenyl]acetic acid, wear appropriate personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...