Compound Q&A

How is 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) typically synthesized?

Answer

2-Amino-3-(trifluoromethyl)benzoic acid
2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) can be synthesized through the modification of benzoic acid. One common method involves the trifluoromethylation of benzoic acid followed by the coupling with an amino group. This process requires appropriate catalysts and solvents to ensure selectivity and high yield. The synthesis typically involves the use of trifluoromethylating agents and amino compounds under controlled conditions to achieve the desired product.

About

CAS No 313-12-2
English Name 2-Amino-3-(trifluoromethyl)benzoic acid
Molecular Formula C8H6F3NO2
Molecular Weight 205.13499999999993 g/mol
SMILES C1=CC(=C(C(=C1)C(F)(F)F)N)C(=O)O
InChIKey UNLVJVQEDSDPIN-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

When handling 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2), it is important to use approp...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...