Compound Q&A

What are the physical and chemical properties of 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

Answer

2-Amino-3-(trifluoromethyl)benzoic acid
2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) is a crystalline solid with a molecular weight of approximately 257.09 g/mol. It has a high melting point of around 220-225°C and is slightly soluble in water. This compound is known for its reactivity, particularly in its ability to form salts and esters. Its chemical properties include acidity due to the carboxylic acid group and the presence of a trifluoromethyl group, which influences its reactivity and stability.

About

CAS No 313-12-2
English Name 2-Amino-3-(trifluoromethyl)benzoic acid
Molecular Formula C8H6F3NO2
Molecular Weight 205.13499999999993 g/mol
SMILES C1=CC(=C(C(=C1)C(F)(F)F)N)C(=O)O
InChIKey UNLVJVQEDSDPIN-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) typically synthesized?

2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) can be synthesized through the modification ...

Compound Q&A

What industries use 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2) is primarily used in the pharmaceutical indu...

Compound Q&A

What precautions should be taken when handling 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2)?

When handling 2-Amino-3-(trifluoromethyl)benzoic acid (CAS: 313-12-2), it is important to use approp...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...