Compound Q&A

How is 4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5) typically synthesized?

Answer

4-[(3-Pyridinylcarbonyl)amino]butanoic acid
4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5) is typically synthesized via the condensation of 4-aminobutanoic acid with 3-pyridinecarboxylic acid. This can be achieved using coupling reagents such as EDC or HATU, with a good yield of up to 80%. The reaction is generally carried out in the presence of a base like triethylamine.

About

CAS No 34562-97-5
English Name 4-[(3-Pyridinylcarbonyl)amino]butanoic acid
Molecular Formula C10H12N2O3
Molecular Weight 208.22 g/mol
SMILES C1=CC(=CN=C1)C(=O)NCCCC(=O)O
InChIKey NAJVRARAUNYNDX-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5)?

4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5) is a white crystalline solid with a mo...

Compound Q&A

What industries use 4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5)?

4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5) is used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5)?

When handling 4-[(3-Pyridinylcarbonyl)amino]butanoic acid (CAS: 34562-97-5), it is important to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...