Compound Q&A

What industries use (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

Answer

(2E)-3-(1H-Indol-2-yl)acrylic acid
(2E)-3-(1H-Indol-2-yl)acrylic acid is primarily used in the pharmaceutical industry for the synthesis of bioactive compounds, particularly in the development of anti-inflammatory and anticancer drugs. It also finds applications in the polymer industry for the modification of polymer properties and in the sensor industry for its use in detecting specific chemical species.

About

CAS No 1204-06-4
English Name (2E)-3-(1H-Indol-2-yl)acrylic acid
Molecular Formula C11H9NO2
Molecular Weight 187.198 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
InChIKey SXOUIMVOMIGLHO-AATRIKPKSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

(2E)-3-(1H-Indol-2-yl)acrylic acid is a white to off-white crystalline solid with a molecular weight...

Compound Q&A

How is (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4) typically synthesized?

(2E)-3-(1H-Indol-2-yl)acrylic acid can be synthesized through a multistep process involving the cond...

Compound Q&A

What precautions should be taken when handling (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

When handling (2E)-3-(1H-Indol-2-yl)acrylic acid, it is essential to wear appropriate personal prote...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...