Compound Q&A

What are the physical and chemical properties of (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

Answer

(2E)-3-(1H-Indol-2-yl)acrylic acid
(2E)-3-(1H-Indol-2-yl)acrylic acid is a white to off-white crystalline solid with a molecular weight of approximately 196.22 g/mol. It has a pKa of 2.7 and is poorly soluble in water but soluble in organic solvents such as ethanol and acetonitrile. The compound is known for its reactivity towards nucleophiles and electrophiles, making it useful in various chemical reactions.

About

CAS No 1204-06-4
English Name (2E)-3-(1H-Indol-2-yl)acrylic acid
Molecular Formula C11H9NO2
Molecular Weight 187.198 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)C=CC(=O)O
InChIKey SXOUIMVOMIGLHO-AATRIKPKSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4) typically synthesized?

(2E)-3-(1H-Indol-2-yl)acrylic acid can be synthesized through a multistep process involving the cond...

Compound Q&A

What industries use (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

(2E)-3-(1H-Indol-2-yl)acrylic acid is primarily used in the pharmaceutical industry for the synthesi...

Compound Q&A

What precautions should be taken when handling (2E)-3-(1H-Indol-2-yl)acrylic acid (CAS: 1204-06-4)?

When handling (2E)-3-(1H-Indol-2-yl)acrylic acid, it is essential to wear appropriate personal prote...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...