Compound Q&A

What industries use 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide (CAS: 3068-32-4)?

Answer

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide
2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is used in the pharmaceutical industry for the synthesis of complex carbohydrates and glycoconjugates. It is also applied in the polymer industry for the development of advanced materials and in biological research for carbohydrate chemistry studies.

About

CAS No 3068-32-4
English Name 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide
Molecular Formula C14H19BrO9
Molecular Weight 411.2 g/mol
SMILES CC(=O)OCC1C(C(C(C(O1)Br)OC(=O)C)OC(=O)C)OC(=O)C
InChIKey CYAYKKUWALRRPA-HTOAHKCRSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide (CAS: 3068-32-4)?

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is a white crystalline solid with a molecula...

Compound Q&A

How is 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide (CAS: 3068-32-4) typically synthesized?

2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide is synthesized through the bromination of 2,...

Compound Q&A

What precautions should be taken when handling 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide (CAS: 3068-32-4)?

Handling 2,3,4,6-Tetra-O-acetyl-alpha-D-galactopyranosyl bromide requires the use of appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...