Compound Q&A

What industries use 2-Methyl-2-propanyl 4-methylbenzoate (CAS: 13756-42-8)?

Answer

2-Methyl-2-propanyl 4-methylbenzoate
2-Methyl-2-propanyl 4-methylbenzoate (CAS: 13756-42-8) is primarily used in the pharmaceutical industry as an intermediate for drug synthesis. It also finds applications in the polymer industry for certain monomer formulations. Additionally, it can be used in the production of some fragrance and flavor compounds, as well as in analytical chemistry for specific reagent applications.

About

CAS No 13756-42-8
English Name 2-Methyl-2-propanyl 4-methylbenzoate
Molecular Formula C12H16O2
Molecular Weight 192.26 g/mol
SMILES CC1=CC=C(C=C1)C(=O)OC(C)(C)C
InChIKey GRUSXPIAJWRLRQ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-methylbenzoate (CAS: 13756-42-8)?

2-Methyl-2-propanyl 4-methylbenzoate (CAS: 13756-42-8) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 2-Methyl-2-propanyl 4-methylbenzoate (CAS: 13756-42-8) typically synthesized?

2-Methyl-2-propanyl 4-methylbenzoate can be synthesized by esterification of 4-methylbenzoic acid wi...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 4-methylbenzoate (CAS: 13756-42-8)?

When handling 2-Methyl-2-proanyl 4-methylbenzoate (CAS: 13756-42-8), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...