Compound Q&A

What are the physical and chemical properties of Cedryl acetate (CAS: 77-54-3)?

Answer

Cedryl acetate
Cedryl acetate (CAS: 77-54-3) is a colorless oily liquid with a strong fragrance. It has a molecular weight of approximately 158.22 g/mol. This compound is soluble in ethanol and ether but insoluble in water. Chemically, it is relatively stable but can react with strong acids and bases. It has a pKa of around 17.5.

About

CAS No 77-54-3
English Name Cedryl acetate
Molecular Formula C17H28O2
Molecular Weight 264.41 g/mol
SMILES CC(O[C@@]1(CC[C@]2(C(C)([C@@H]3C[C@]12CC[C@H]3C)C)[H])C)=O
InChIKey OETMLOBORLMQPE-YIUHCBHRSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

How is Cedryl acetate (CAS: 77-54-3) typically synthesized?

Cedryl acetate is typically synthesized by the esterification of cedrol with acetic acid using a str...

Compound Q&A

What industries use Cedryl acetate (CAS: 77-54-3)?

Cedryl acetate (CAS: 77-54-3) is widely used in the fragrance and flavor industry due to its pleasan...

Compound Q&A

What precautions should be taken when handling Cedryl acetate (CAS: 77-54-3)?

When handling Cedryl acetate (CAS: 77-54-3), it is essential to wear appropriate personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...