Compound Q&A

How is 3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1) typically synthesized?

Answer

3-Amino-1,5-naphthalenedisulfonic acid
3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1) is typically synthesized by the sulfonation of 1,5-naphthalenedisulfonic acid followed by alkylation and reduction. Common catalysts include sulfuric acid and hydrogen bromide. The process yields a product with high purity and selectivity.

About

CAS No 131-27-1
English Name 3-Amino-1,5-naphthalenedisulfonic acid
Molecular Formula C10H9NO6S2
Molecular Weight 303.32 g/mol
SMILES C1=CC2=C(C=C(C=C2S(=O)(=O)O)N)C(=C1)S(=O)(=O)O
InChIKey MTJGVAJYTOXFJH-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1)?

3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1) is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1)?

3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1)?

When handling 3-Amino-1,5-naphthalenedisulfonic acid (CAS: 131-27-1), use personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...