Compound Q&A

What industries use steviolbioside (CAS: 41093-60-1)?

Answer

steviolbioside
Steviolbioside is primarily used in the food and pharmaceutical industries. In the food industry, it is a natural sweetener used in beverages, confectionery, and bakery products. In pharmaceuticals, it serves as an ingredient in dietary supplements and functional foods due to its low-calorie and non-cariogenic properties.

About

CAS No 41093-60-1
English Name steviolbioside
Molecular Formula C32H50O13
Molecular Weight 642.74 g/mol
SMILES C[C@]1(CCC[C@@]2(C)[C@@H]3CC[C@@]4(C[C@]3(CC4=C)CC[C@H]12)O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C(=O)O
InChIKey OMHUCGDTACNQEX-OSHKXICASA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of steviolbioside (CAS: 41093-60-1)?

Steviolbioside is a sweet-tasting natural compound with a molecular weight of approximately 448.28 g...

Compound Q&A

How is steviolbioside (CAS: 41093-60-1) typically synthesized?

Steviolbioside is typically synthesized using enzymatic methods. Commonly, the enzyme Stevioside syn...

Compound Q&A

What precautions should be taken when handling steviolbioside (CAS: 41093-60-1)?

Proper handling of steviolbioside requires the use of personal protective equipment (PPE) such as gl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...