Compound Q&A

What industries use 2,3-Dichloro-5-(trichloromethyl)pyridine (CAS: 69045-83-6)?

Answer

2,3-Dichloro-5-(trichloromethyl)pyridine
2,3-Dichloro-5-(trichloromethyl)pyridine is used in the pharmaceutical industry for the synthesis of certain antiviral drugs. It is also explored for its potential use in the production of sensors and as a precursor in the semiconductor industry.

About

CAS No 69045-83-6
English Name 2,3-Dichloro-5-(trichloromethyl)pyridine
Molecular Formula C6H2Cl5N
Molecular Weight 265.35 g/mol
SMILES C1=C(C=NC(=C1Cl)Cl)C(Cl)(Cl)Cl
InChIKey XVBWGQSXLITICX-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dichloro-5-(trichloromethyl)pyridine (CAS: 69045-83-6)?

2,3-Dichloro-5-(trichloromethyl)pyridine is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 2,3-Dichloro-5-(trichloromethyl)pyridine (CAS: 69045-83-6) typically synthesized?

2,3-Dichloro-5-(trichloromethyl)pyridine is synthesized via the condensation of 2,3-dichloropyridine...

Compound Q&A

What precautions should be taken when handling 2,3-Dichloro-5-(trichloromethyl)pyridine (CAS: 69045-83-6)?

When handling 2,3-Dichloro-5-(trichloromethyl)pyridine, gloves, goggles, and a lab coat should be wo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...