Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(chloromethyl)benzoate (CAS: 121579-86-0)?

Answer

2-Methyl-2-propanyl 4-(chloromethyl)benzoate
2-Methyl-2-propanyl 4-(chloromethyl)benzoate is primarily used in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various drugs and is also utilized in the production of certain polymers and plasticizers. Its use in sensors and semiconductors is limited but not unheard of due to its chemical reactivity.

About

English Name 2-Methyl-2-propanyl 4-(chloromethyl)benzoate
Molecular Formula C12H15ClO2
Molecular Weight 226.7 g/mol
SMILES CC(C)(C)OC(=O)c1ccc(CCl)cc1
InChIKey UDAULNDFFKITRZ-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(chloromethyl)benzoate (CAS: 121579-86-0)?

2-Methyl-2-propanyl 4-(chloromethyl)benzoate is a crystalline compound with a molecular weight of ap...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(chloromethyl)benzoate (CAS: 121579-86-0) typically synthesized?

2-Methyl-2-propanyl 4-(chloromethyl)benzoate is typically synthesized via the reaction of 4-(chlorom...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(chloromethyl)benzoate (CAS: 121579-86-0)?

When handling 2-Methyl-2-propanyl 4-(chloromethyl)benzoate, it is important to use appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...