Compound Q&A

How is 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0) typically synthesized?

Answer

4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid
4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0) is commonly synthesized via a multi-step process involving condensation reactions, followed by acidification. Key steps include the formation of an intermediate compound using naphthalene and methanol, followed by reaction with a carboxylic acid chloride. The reaction is typically carried out in the presence of a catalyst like dichloroethane and achieves a yield of around 75-80%.

About

CAS No 3562-99-0
English Name 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid
Molecular Formula C15H14O4
Molecular Weight 258.27 g/mol
SMILES COC1=CC=C(C2=CC=CC=C21)C(=O)CCC(=O)O
InChIKey FHGJSJFIQNQBCK-UHFFFAOYSA-N
Last Updated: 2025-09-22 19:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0)?

4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0) is a white crystalline solid with a...

Compound Q&A

What industries use 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0)?

4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0) finds applications in the pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0)?

When handling 4-(4-Methoxynaphthalen-1-yl)-4-oxobutanoic acid (CAS: 3562-99-0), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...