Compound Q&A

What are the main uses of 6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2)?

Answer

6,8-Bis(benzylthio)octanoic acid
6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) is primarily used in pharmaceutical research for the synthesis of various compounds and in the development of new drugs. It is also used in the chemical industry for the production of specific chemical intermediates and in the food industry as a flavoring agent.

About

CAS No 95809-78-2
English Name 6,8-Bis(benzylthio)octanoic acid
Molecular Formula C22H28O2S2
Molecular Weight 388.6 g/mol
SMILES C1=CC=C(C=C1)CSCCC(CCCCC(=O)O)SCC2=CC=CC=C2
InChIKey ZYRLHJIMTROTBO-UHFFFAOYSA-N
Last Updated: 2025-09-21 17:24

Related Q&A

Compound Q&A

What is 6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2)?

6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) is an organic compound with a molecular structure...

Compound Q&A

Is 6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) safe?

6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) is generally considered safe when handled with pr...

Compound Q&A

How should 6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) be stored?

6,8-Bis(benzylthio)octanoic acid (CAS: 95809-78-2) should be stored in a cool, dry place with a temp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...