Compound Q&A

How should 2-Methyl-2-proanyl 4-methylene-1-piperidinecarboxylate (CAS: 159635-49-1) be stored?

Answer

2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate
2-Methyl-2-proanyl 4-methylene-1-piperidinecarboxylate should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a closed container to prevent evaporation and maintain its stability. The storage temperature should not exceed 25°C, and the container should be tightly sealed to prevent moisture and air exposure.

About

English Name 2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate
Molecular Formula C11H19NO2
Molecular Weight 197.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(=C)CC1
InChIKey PDTZMULNKGUIEJ-UHFFFAOYSA-N
Last Updated: 2025-09-21 17:24

Related Q&A

Compound Q&A

What is 2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate (CAS: 159635-49-1)?

2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate is a chemical compound with the CAS number 1...

Compound Q&A

What are the main uses of 2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate (CAS: 159635-49-1)?

2-Methyl-2-propanyl 4-methylene-1-piperidinecarboxylate is primarily used as a precursor in the synt...

Compound Q&A

Is 2-Methyl-2-proanyl 4-methylene-1-piperidinecarboxylate (CAS: 159635-49-1) safe?

2-Methyl-2-proanyl 4-methylene-1-piperidinecarboxylate is generally considered safe for laboratory u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...