Compound Q&A

Is 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8) safe?

Answer

3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (1:1)
3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8) is generally considered safe when used appropriately. However, it should be handled with care due to its acidic nature. Protective measures include using appropriate personal protective equipment (PPE) such as gloves and goggles. Spills should be handled according to standard chemical waste disposal protocols.

About

English Name 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (1:1)
Molecular Formula C12H15ClN2O3S
Molecular Weight 302.78 g/mol
SMILES C1C(CNC1C(=O)NC2=CC=CC(=C2)C(=O)O)S.Cl
InChIKey DDRIIBZWSJDJQQ-IYPAPVHQSA-N
Last Updated: 2025-09-21 17:24

Related Q&A

Compound Q&A

What is 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8)?

3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8) is a pharmaceutical...

Compound Q&A

What are the main uses of 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8)?

The primary uses of 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride include its applic...

Compound Q&A

How should 3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8) be stored?

3-{[(4S)-4-Sulfanyl-L-prolyl]amino}benzoic acid hydrochloride (CAS: 219909-83-8) should be stored in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...