Compound Q&A

Are there alternatives to 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7) in synthesis?

Answer

2,4,5-Trifluoro-3-hydroxybenzoic acid
In the synthesis of 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7), alternatives such as 2,4-difluoro-3-hydroxybenzoic acid or 4-fluoro-3-hydroxybenzoic acid can be used. These alternatives can serve as viable substitutes depending on the specific reaction conditions and desired product purity. Other common reagents that may be considered include benzoic acid derivatives with varying fluorine positions or substituents.

About

English Name 2,4,5-Trifluoro-3-hydroxybenzoic acid
Molecular Formula C7H3F3O3
Molecular Weight 192.09 g/mol
SMILES C1=C(C(=C(C(=C1F)F)O)F)C(=O)O
InChIKey YYAFUGSJSHXYNK-UHFFFAOYSA-N
Last Updated: 2025-09-21 10:38

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7)?

2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7) falls under the scope of the Globally Harmo...

Compound Q&A

What is the market or research trend for 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7)?

The market for 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7) is primarily driven by its a...

Compound Q&A

How should waste containing 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7) be handled?

Waste containing 2,4,5-Trifluoro-3-hydroxybenzoic acid (CAS: 116751-24-7) should be collected and di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...