Compound Q&A

Are there alternatives to 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid in synthesis?

Answer

6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid
There are alternative reagents often used in synthesis such as hexamethylene diisocyanate or adipic acid. These compounds serve similar functions but may have different physical properties and reactivity profiles, making them suitable for specific applications. The choice depends on the desired end product and the process conditions.

About

CAS No 80584-91-4
English Name 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid
Molecular Formula C21H36N6O6
Molecular Weight 468.56 g/mol
SMILES C(CCC(=O)O)CCNC1=NC(=NC(=N1)NCCCCCC(=O)O)NCCCCCC(=O)O
InChIKey BKKWPPMEXIXECW-UHFFFAOYSA-N
Last Updated: 2025-09-21 10:38

Related Q&A

Compound Q&A

What regulatory guidelines apply to 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid (CAS: 80584-91-4)?

6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid (CAS: 80584-91-4) requires adherence t...

Compound Q&A

What is the market or research trend for 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid (CAS: 80584-91-4)?

The market for 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid is growing due to its u...

Compound Q&A

How should waste containing 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid (CAS: 80584-91-4) be handled?

Waste containing 6,6',6''-(1,3,5-Triazine-2,4,6-triyltriimino)trihexanoic acid should be collected a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...