Compound Q&A

Are there alternatives to 3,5-Dichloro-2-pyridinecarboxylic acid (CAS: 81719-53-1) in synthesis?

Answer

3,5-Dichloro-2-pyridinecarboxylic acid
Alternatives to 3,5-Dichloro-2-pyridinecarboxylic acid include other pyridine carboxylic acids with different substituents, such as 2-chloro-3-pyridinecarboxylic acid, or similar compounds like 3,5-Dinitro-2-pyridinecarboxylic acid. Common substitutes might include commercially available reagents like chloroacetic acid or other halogenated compounds, depending on the specific synthetic pathway.

About

CAS No 81719-53-1
English Name 3,5-Dichloro-2-pyridinecarboxylic acid
Molecular Formula C6H3Cl2NO2
Molecular Weight 192 g/mol
SMILES C1=C(C=NC(=C1Cl)C(=O)O)Cl
InChIKey JYKZCYLZWZCQFP-UHFFFAOYSA-N
Last Updated: 2025-09-21 10:38

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3,5-Dichloro-2-pyridinecarboxylic acid (CAS: 81719-53-1)?

3,5-Dichloro-2-pyridinecarboxylic acid (CAS: 81719-53-1) must comply with the Globally Harmonized Sy...

Compound Q&A

What is the market or research trend for 3,5-Dichloro-2-pyridinecarboxylic acid (CAS: 81719-53-1)?

The market for 3,5-Dichloro-2-pyridinecarboxylic acid is primarily driven by its use in the pharmace...

Compound Q&A

How should waste containing 3,5-Dichloro-2-pyridinecarboxylic acid (CAS: 81719-53-1) be handled?

Waste containing 3,5-Dichloro-2-pyridinecarboxylic acid should be collected in appropriate container...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...