Compound Q&A

Are there alternatives to (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) in synthesis?

Answer

(4-Chloro-3-methylphenyl)boronic acid
Alternatives to (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) in synthesis include other aryl boronic acids, such as (3-Methylphenyl)boronic acid, or using other coupling reagents like diethyl azodicarboxylate (DEAD). These alternatives may offer similar reactivity but with different functionalities or reactivity profiles, making them suitable for various synthetic routes and chemical reactions.

About

English Name (4-Chloro-3-methylphenyl)boronic acid
Molecular Formula C7H8BClO2
Molecular Weight 170.4 g/mol
SMILES B(C1=CC(=C(C=C1)Cl)C)(O)O
InChIKey UZDPQDBLCJDUAX-UHFFFAOYSA-N
Last Updated: 2025-09-21 10:38

Related Q&A

Compound Q&A

What regulatory guidelines apply to (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3)?

Regulatory guidelines for (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) include the globa...

Compound Q&A

What is the market or research trend for (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3)?

The market for (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) is growing due to its applic...

Compound Q&A

How should waste containing (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) be handled?

Waste containing (4-Chloro-3-methylphenyl)boronic acid (CAS: 161950-10-3) should be handled accordin...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...