Compound Q&A

Are there alternatives to Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9) in synthesis?

Answer

Dibenzo[b,d]thiophen-2-ylboronic acid
Yes, there are alternatives to Dibenzo[b,d]thiophen-2-ylboronic acid, such as other boronic acids and derivatives like phenylboronic acid or diphenylboronic acid, which can be used as equivalent reagents in synthesis. Additionally, isomers of thiophene-based boronic acids may serve as viable alternatives depending on the specific reaction conditions.

About

English Name Dibenzo[b,d]thiophen-2-ylboronic acid
Molecular Formula C12H9BO2S
Molecular Weight 228.08 g/mol
SMILES B(C1=CC2=C(C=C1)SC3=CC=CC=C32)(O)O
InChIKey CSLSCVHILGCSTE-UHFFFAOYSA-N
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9)?

Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9) is subject to regulatory guidelines such as...

Compound Q&A

What is the market or research trend for Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9)?

The market for Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9) is growing due to its applic...

Compound Q&A

How should waste containing Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9) be handled?

Waste containing Dibenzo[b,d]thiophen-2-ylboronic acid (CAS: 668983-97-9) should be collected in app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...