Compound Q&A

Are there alternatives to 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) in synthesis?

Answer

2-Amino-4-(trifluoromethyl)benzoic acid
In synthesis, 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) is often used as a key intermediate in the production of pharmaceuticals. Alternatives include using 2-Amino-4-(methylthio)benzoic acid or 2-Amino-4-(methoxy)benzoic acid, which have similar functional groups but different substituents. These alternatives can be considered based on the desired properties and cost-effectiveness of the final product.

About

CAS No 402-13-1
English Name 2-Amino-4-(trifluoromethyl)benzoic acid
Molecular Formula C8H6F3NO2
Molecular Weight 205.13 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)N)C(=O)O
InChIKey NQTLZJODEOHALT-UHFFFAOYSA-N
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1)?

2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) falls under various regulatory guidelines. I...

Compound Q&A

What is the market or research trend for 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1)?

The market for 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) is driven by its applications...

Compound Q&A

How should waste containing 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) be handled?

Waste containing 2-Amino-4-(trifluoromethyl)benzoic acid (CAS: 402-13-1) should be managed according...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...