Compound Q&A

Are there alternatives to Ciwujianoside B (CAS: 114902-16-8) in synthesis?

Answer

Ciwujianoside B
In the synthesis of natural products like Ciwujianoside B (CAS: 114902-16-8), alternatives include using similar triterpene derivatives such as ursolic acid and oleanolic acid. Isomers and analogs of Ciwujianoside B can also serve as useful alternatives, and researchers often explore the use of biocatalysis and green chemistry approaches to produce these compounds more sustainably.

About

English Name Ciwujianoside B
Molecular Formula C58H92O25
Molecular Weight 1189.3 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(=C)CC4C6=CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)C)OC9C(C(C(CO9)O)O)OC1C(C(C(C(O1)C)O)O)O)C)O)O)O)CO)O)O)O
InChIKey UPROOJBJZLZCGS-CHTHVDMYSA-N
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ciwujianoside B (CAS: 114902-16-8)?

Ciwujianoside B (CAS: 114902-16-8) falls under the classification of a secondary metabolite. Regulat...

Compound Q&A

What is the market or research trend for Ciwujianoside B (CAS: 114902-16-8)?

The market for Ciwujianoside B (CAS: 114902-16-8) is driven by its potential in traditional Chinese ...

Compound Q&A

How should waste containing Ciwujianoside B (CAS: 114902-16-8) be handled?

Waste containing Ciwujianoside B (CAS: 114902-16-8) should be managed according to local and interna...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...