Compound Q&A

What is the market or research trend for Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9)?

Answer

Titanium(IV) oxysulfate-sulfuric acid hydrate
The market for Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) is driven by its use in the production of titanium dioxide, which is essential in various industries such as paint, paper, and cosmetics. Research trends are focusing on developing more efficient and environmentally friendly synthesis methods to increase the yield and reduce waste. Additionally, there is growing interest in the use of this compound in advanced materials and coatings, driven by its unique properties.

About

English Name Titanium(IV) oxysulfate-sulfuric acid hydrate
Molecular Formula H4O9S2Ti
Molecular Weight 260.02 g/mol
SMILES OS(=O)(=O)O.OS(=O)(=O)O.[Ti]=O
InChIKey WPHUABLDMNBRPA-UHFFFAOYSA-N
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9)?

Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) is regulated by various agencies in...

Compound Q&A

Are there alternatives to Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) in synthesis?

Alternatives to Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) in synthesis includ...

Compound Q&A

How should waste containing Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) be handled?

Waste containing Titanium(IV) oxysulfate-sulfuric acid hydrate (CAS: 123334-00-9) should be collecte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...