Compound Q&A

Are there alternatives to Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) in synthesis?

Answer

Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate]
In synthesis, Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) can be replaced by similar vanadium complexes such as vanadyl acetylacetonate or other vanadium carboxylates. These alternatives offer similar catalytic properties and reactivity, making them viable substitutes in various chemical reactions. Additionally, researchers often explore other organometallic complexes or transition metal complexes depending on the specific application requirements.

About

CAS No 13476-99-8
English Name Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate]
Molecular Formula C15H21O6V
Molecular Weight 348.27 g/mol
EINECS 236-759-1
SMILES C/C(=C/C(=O)C)/O[V](O/C(=C\C(=O)C)/C)O/C(=C\C(=O)C)/C
InChIKey JTPOGAMSYINTGF-LNTINUHCSA-K
Last Updated: 2025-09-20 20:46

Related Q&A

Compound Q&A

What regulatory guidelines apply to Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8)?

Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) is regulated under the Globally Har...

Compound Q&A

What is the market or research trend for Vanadium(3+) tris[(2Z)-4-2-penten-2-olate] (CAS: 13476-99-8)?

There is growing interest in Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) within...

Compound Q&A

How should waste containing Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) be handled?

Waste containing Vanadium(3+) tris[(2Z)-4-oxo-2-penten-2-olate] (CAS: 13476-99-8) should be collecte...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...