Compound Q&A

What are the physical and chemical properties of 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) (CAS: 52628-03-2)?

Answer

2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1)
2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) is a crystalline compound with a molecular weight of approximately 236.2 g/mol. It has a low solubility in water but is soluble in organic solvents. It is reactive and can participate in polymerization reactions. Its chemical stability is moderate at room temperature but degrades under acidic or basic conditions.

About

CAS No 52628-03-2
English Name 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1)
Molecular Formula C6H13O7P
Molecular Weight 228.14 g/mol
SMILES CC(=C)C(=O)OCCO.OP(=O)(O)O
InChIKey POLZHVHESHDZRD-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) (CAS: 52628-03-2) typically synthesized?

2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) is synthesized by the esterification of 2-hy...

Compound Q&A

What industries use 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) (CAS: 52628-03-2)?

2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1) (CAS: 52628-03-2)?

When handling 2-Hydroxyethyl 2-methylacrylate - phosphoric acid (1:1), wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...