Compound Q&A

What precautions should be taken when handling 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

Answer

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride
When handling 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risk. Spills should be handled with appropriate absorbents and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

English Name 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride
Molecular Formula C13H19Cl3N2O
Molecular Weight 325.7 g/mol
SMILES CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)Cl.Cl.Cl
InChIKey DDKLQZDSVJKYLJ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is a crystalline solid with a molecula...

Compound Q&A

How is 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7) typically synthesized?

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is typically synthesized via the amida...

Compound Q&A

What industries use 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is used in pharmaceuticals for the syn...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...