Compound Q&A

What industries use 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

Answer

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride
4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is used in pharmaceuticals for the synthesis of certain drug intermediates. It is also employed in the polymer industry for the development of functional polymers and as a monomer for sensor technology. Additionally, it is utilized in the electronics industry for the production of semiconductors and other electronic components.

About

English Name 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride
Molecular Formula C13H19Cl3N2O
Molecular Weight 325.7 g/mol
SMILES CN1CCN(CC1)CC2=CC=C(C=C2)C(=O)Cl.Cl.Cl
InChIKey DDKLQZDSVJKYLJ-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is a crystalline solid with a molecula...

Compound Q&A

How is 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7) typically synthesized?

4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride is typically synthesized via the amida...

Compound Q&A

What precautions should be taken when handling 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride (CAS: 106261-64-7)?

When handling 4-(4-Methylpiperazinylmethyl)benzoyl chloride dihydrochloride, it is essential to use ...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...