Compound Q&A

What are the physical and chemical properties of 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2)?

Answer

2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid
2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2) is a colorless crystalline solid with a high molecular weight. It has a low solubility in water and is known for its chelating properties. This compound is highly reactive toward metal ions, making it useful in various applications requiring effective metal complexation.

About

CAS No 1939-36-2
English Name 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid
Molecular Formula C11H18N2O8
Molecular Weight 306.27 g/mol
SMILES C(CN(CC(=O)O)CC(=O)O)CN(CC(=O)O)CC(=O)O
InChIKey DMQQXDPCRUGSQB-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2) typically synthesized?

2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2) is synthesized through the...

Compound Q&A

What industries use 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2)?

2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2) is used in pharmaceuticals...

Compound Q&A

What precautions should be taken when handling 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2)?

When handling 2,2',2'',2'''-(1,3-Propanediyldinitrilo)tetraacetic acid (CAS: 1939-36-2), ensure to u...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...