Compound Q&A

How is Triphenylstibine (CAS: 603-36-1) typically synthesized?

Answer

Triphenylstibine
Triphenylstibine (CAS: 603-36-1) is commonly synthesized via the reaction of triphenylphosphine and arsine in the presence of a base such as potassium hydroxide. The reaction is typically carried out in an inert atmosphere to prevent side reactions. The yield is usually high, and the product is purified by distillation under reduced pressure due to its low boiling point.

About

CAS No 603-36-1
English Name Triphenylstibine
Molecular Formula C18H15Sb
Molecular Weight 353.08 g/mol
SMILES C1=CC=C(C=C1)[Sb](C2=CC=CC=C2)C3=CC=CC=C3
InChIKey HVYVMSPIJIWUNA-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Triphenylstibine (CAS: 603-36-1)?

Triphenylstibine (CAS: 603-36-1) is a colorless, fuming liquid at room temperature. It has a molecul...

Compound Q&A

What industries use Triphenylstibine (CAS: 603-36-1)?

Triphenylstibine (CAS: 603-36-1) is used in various industries. It is employed as a precursor in the...

Compound Q&A

What precautions should be taken when handling Triphenylstibine (CAS: 603-36-1)?

When handling Triphenylstibine (CAS: 603-36-1), it is essential to follow strict safety procedures. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...