Compound Q&A

What are the physical and chemical properties of 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone (CAS: 66346-01-8)?

Answer

1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone
1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone is a colorless to light yellow crystalline solid with a molecular weight of approximately 219.16 g/mol. It has a high melting point of around 112-114°C and is slightly soluble in water but soluble in organic solvents such as ethanol and acetone. The compound is relatively stable under neutral conditions but can react with strong bases. It shows reactivity towards nucleophiles and can undergo functional group transformations.

About

CAS No 66346-01-8
English Name 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone
Molecular Formula C13H17ClO
Molecular Weight 224.73 g/mol
SMILES CC(C)(C)C(=O)CCC1=CC=C(C=C1)Cl
InChIKey ILQGIJDYSLHIOX-UHFFFAOYSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

How is 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone (CAS: 66346-01-8) typically synthesized?

1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone is typically synthesized via a multistep process startin...

Compound Q&A

What industries use 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone (CAS: 66346-01-8)?

1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone is used in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone (CAS: 66346-01-8)?

When handling 1-(4-Chlorophenyl)-4,4-dimethyl-3-pentanone, it is important to wear appropriate perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...