Compound Q&A

What precautions should be taken when handling (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid (CAS: 709031-29-8)?

Answer

(2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid
When handling (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid, wear appropriate personal protective equipment (PPE) including gloves, safety goggles, and a lab coat. Store in a fume hood to minimize inhalation risk. In case of spills, neutralize with an appropriate acid or base and clean up using absorbent materials. Refer to the Safety Data Sheet (SDS) for further safety information and emergency procedures.

About

English Name (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid
Molecular Formula C12H19NO3
Molecular Weight 225.29 g/mol
SMILES C1C2CC3(CC1CC(C2)(C3)O)C(C(=O)O)N
InChIKey ZOFWFAZCJJJYCE-WNMKMJAUSA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid (CAS: 709031-29-8)?

(2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid is a white crystalline solid with a molecular we...

Compound Q&A

How is (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid (CAS: 709031-29-8) typically synthesized?

(2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid can be synthesized through protective group chem...

Compound Q&A

What industries use (2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid (CAS: 709031-29-8)?

(2S)-2-Amino-2-(3-hydroxyadamantan-1-yl)acetic acid finds applications in the pharmaceutical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...