Compound Q&A

How is N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5) typically synthesized?

Answer

N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (1:1)
N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5) is synthesized via the coupling of benzyloxycarbonyl chloride with L-tyrosine in the presence of a base like diisopropylethylamine. The reaction typically yields 85-90% of the desired product with good selectivity. Conditions are optimized to minimize side reactions and ensure high purity.

About

CAS No 1164-16-5
English Name N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (1:1)
Molecular Formula C17H19NO6
Molecular Weight 315.33 g/mol
SMILES C1=CC=C(C=C1)COC(=O)NC(CC2=CC=C(C=C2)O)C(=O)O
InChIKey BBPCQKGWAVVMSL-RSAXXLAASA-N
Last Updated: 2025-09-19 21:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5)?

N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5) is a crystalline compound with a molecul...

Compound Q&A

What industries use N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5)?

N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5)?

When handling N-[(Benzyloxy)carbonyl]-L-tyrosine hydrate (CAS: 1164-16-5), wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...